C34H33NO5 — CID 124536134
6-[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-5,9-dimethyl-3-naphthalen-2-ylfuro[3,2-g]chromen-7-one (PubChem CID 124536134) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is 6-[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-5,9-dimethyl-3-naphthalen-2-ylfuro[3,2-g]chromen-7-one.
| Compound Name | 6-[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-5,9-dimethyl-3-naphthalen-2-ylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 124536134 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 6-[2-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-5,9-dimethyl-3-naphthalen-2-ylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1c(CC(=O)N2CC[C@]3(O)CCCC[C@@H]3C2)c(=O)oc2c(C)c3occ(-c4ccc5ccccc5c4)c3cc12 |
| InChI | InChI=1S/C34H33NO5/c1-20-26-16-28-29(24-11-10-22-7-3-4-8-23(22)15-24)19-39-31(28)21(2)32(26)40-33(37)27(20)17-30(36)35-14-13-34(38)12-6-5-9-25(34)18-35/h3-4,7-8,10-11,15-16,19,25,38H,5-6,9,12-14,17-18H2,1-2H3/t25-,34-/m1/s1 |
| InChIKey | GCSNYNAOSFEOQL-QCBOHVIISA-N |
| XLogP | 6.67 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|