C36H35NO5 — CID 6998127
6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-5-methyl-3-(4-phenylphenyl)furo[3,2-g]chromen-7-one (PubChem CID 6998127) has the molecular formula C36H35NO5 and a molecular weight of 561.68 g/mol. Its IUPAC name is 6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-5-methyl-3-(4-phenylphenyl)furo[3,2-g]chromen-7-one.
| Compound Name | 6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-5-methyl-3-(4-phenylphenyl)furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 6998127 |
| Molecular Formula | C36H35NO5 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-5-methyl-3-(4-phenylphenyl)furo[3,2-g]chromen-7-one |
| SMILES | Cc1c(CCC(=O)N2CC[C@@]3(O)CCCC[C@@H]3C2)c(=O)oc2cc3occ(-c4ccc(-c5ccccc5)cc4)c3cc12 |
| InChI | InChI=1S/C36H35NO5/c1-23-28(14-15-34(38)37-18-17-36(40)16-6-5-9-27(36)21-37)35(39)42-33-20-32-30(19-29(23)33)31(22-41-32)26-12-10-25(11-13-26)24-7-3-2-4-8-24/h2-4,7-8,10-13,19-20,22,27,40H,5-6,9,14-18,21H2,1H3/t27-,36+/m1/s1 |
| InChIKey | RLKJYBFXUNJOPR-YHZWMNSLSA-N |
| XLogP | 7.27 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|