C30H30BrNO5 — CID 6570772
6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-3-(4-bromophenyl)-5-methylfuro[3,2-g]chromen-7-one (PubChem CID 6570772) has the molecular formula C30H30BrNO5 and a molecular weight of 564.48 g/mol. Its IUPAC name is 6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-3-(4-bromophenyl)-5-methylfuro[3,2-g]chromen-7-one.
| Compound Name | 6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-3-(4-bromophenyl)-5-methylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 6570772 |
| Molecular Formula | C30H30BrNO5 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 6-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-3-(4-bromophenyl)-5-methylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1c(CCC(=O)N2CC[C@@]3(O)CCCC[C@@H]3C2)c(=O)oc2cc3occ(-c4ccc(Br)cc4)c3cc12 |
| InChI | InChI=1S/C30H30BrNO5/c1-18-22(9-10-28(33)32-13-12-30(35)11-3-2-4-20(30)16-32)29(34)37-27-15-26-24(14-23(18)27)25(17-36-26)19-5-7-21(31)8-6-19/h5-8,14-15,17,20,35H,2-4,9-13,16H2,1H3/t20-,30+/m1/s1 |
| InChIKey | YEUWQSYYDWFVSP-KEEVHDRGSA-N |
| XLogP | 6.36 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|