C32H28N2O5 — CID 99885230
(1R,9S)-11-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 99885230) has the molecular formula C32H28N2O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is (1R,9S)-11-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 99885230 |
| Molecular Formula | C32H28N2O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (1R,9S)-11-[3-(5-methyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1c(CCC(=O)N2C[C@@H]3C[C@H](C2)c2cccc(=O)n2C3)c(=O)oc2cc3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C32H28N2O5/c1-19-23(10-11-30(35)33-15-20-12-22(17-33)27-8-5-9-31(36)34(27)16-20)32(37)39-29-14-28-25(13-24(19)29)26(18-38-28)21-6-3-2-4-7-21/h2-9,13-14,18,20,22H,10-12,15-17H2,1H3/t20-,22+/m0/s1 |
| InChIKey | DVPVMSXVKTVDKE-RBBKRZOGSA-N |
| XLogP | 5.25 |
| TPSA | 85.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|