C34H37NO5 — CID 6570975
3-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-4-methyl-7-[(1-methylnaphthalen-2-yl)methoxy]chromen-2-one (PubChem CID 6570975) has the molecular formula C34H37NO5 and a molecular weight of 539.67 g/mol. Its IUPAC name is 3-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-4-methyl-7-[(1-methylnaphthalen-2-yl)methoxy]chromen-2-one.
| Compound Name | 3-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-4-methyl-7-[(1-methylnaphthalen-2-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 6570975 |
| Molecular Formula | C34H37NO5 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 3-[3-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-oxopropyl]-4-methyl-7-[(1-methylnaphthalen-2-yl)methoxy]chromen-2-one |
| SMILES | Cc1c(COc2ccc3c(C)c(CCC(=O)N4CC[C@@]5(O)CCCC[C@@H]5C4)c(=O)oc3c2)ccc2ccccc12 |
| InChI | InChI=1S/C34H37NO5/c1-22-25(11-10-24-7-3-4-9-28(22)24)21-39-27-12-13-29-23(2)30(33(37)40-31(29)19-27)14-15-32(36)35-18-17-34(38)16-6-5-8-26(34)20-35/h3-4,7,9-13,19,26,38H,5-6,8,14-18,20-21H2,1-2H3/t26-,34+/m1/s1 |
| InChIKey | VCMYDIKVDKFNLT-SFRLIIPVSA-N |
| XLogP | 6.23 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|