C33H35NO5 — CID 4593100
3-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-4-methyl-7-[(2-methylnaphthalen-1-yl)methoxy]chromen-2-one (PubChem CID 4593100) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 3-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-4-methyl-7-[(2-methylnaphthalen-1-yl)methoxy]chromen-2-one.
| Compound Name | 3-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-4-methyl-7-[(2-methylnaphthalen-1-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 4593100 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 3-[2-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-2-oxoethyl]-4-methyl-7-[(2-methylnaphthalen-1-yl)methoxy]chromen-2-one |
| SMILES | Cc1ccc2ccccc2c1COc1ccc2c(C)c(CC(=O)N3CCC4(O)CCCCC4C3)c(=O)oc2c1 |
| InChI | InChI=1S/C33H35NO5/c1-21-10-11-23-7-3-4-9-27(23)29(21)20-38-25-12-13-26-22(2)28(32(36)39-30(26)17-25)18-31(35)34-16-15-33(37)14-6-5-8-24(33)19-34/h3-4,7,9-13,17,24,37H,5-6,8,14-16,18-20H2,1-2H3 |
| InChIKey | OAZWRQIEBBNRAH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|