C29H32BrNO5 — CID 6570596
3-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(2-bromophenyl)methoxy]-4,8-dimethylchromen-2-one (PubChem CID 6570596) has the molecular formula C29H32BrNO5 and a molecular weight of 554.48 g/mol. Its IUPAC name is 3-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(2-bromophenyl)methoxy]-4,8-dimethylchromen-2-one.
| Compound Name | 3-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(2-bromophenyl)methoxy]-4,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 6570596 |
| Molecular Formula | C29H32BrNO5 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 3-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7-[(2-bromophenyl)methoxy]-4,8-dimethylchromen-2-one |
| SMILES | Cc1c(CC(=O)N2CC[C@@]3(O)CCCC[C@@H]3C2)c(=O)oc2c(C)c(OCc3ccccc3Br)ccc12 |
| InChI | InChI=1S/C29H32BrNO5/c1-18-22-10-11-25(35-17-20-7-3-4-9-24(20)30)19(2)27(22)36-28(33)23(18)15-26(32)31-14-13-29(34)12-6-5-8-21(29)16-31/h3-4,7,9-11,21,34H,5-6,8,12-17H2,1-2H3/t21-,29+/m1/s1 |
| InChIKey | FGAONPOSDORSCH-PBBNMVCDSA-N |
| XLogP | 5.45 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|