C27H25NO6 — CID 4266891
1-[2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]piperidine-2-carboxylic acid (PubChem CID 4266891) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 1-[2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 4266891 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[2-(5,9-dimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)acetyl]piperidine-2-carboxylic acid |
| SMILES | Cc1c(CC(=O)N2CCCCC2C(=O)O)c(=O)oc2c(C)c3occ(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C27H25NO6/c1-15-18-12-20-21(17-8-4-3-5-9-17)14-33-24(20)16(2)25(18)34-27(32)19(15)13-23(29)28-11-7-6-10-22(28)26(30)31/h3-5,8-9,12,14,22H,6-7,10-11,13H2,1-2H3,(H,30,31) |
| InChIKey | PPPVUBGEIAJAOQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|