C20H17ClN2O4 — CID 4910911
2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 4910911) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is 2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4910911 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(COc1cc2oc(=O)c3c(c2cc1Cl)CCC3)NCc1ccncc1 |
| InChI | InChI=1S/C20H17ClN2O4/c21-16-8-15-13-2-1-3-14(13)20(25)27-17(15)9-18(16)26-11-19(24)23-10-12-4-6-22-7-5-12/h4-9H,1-3,10-11H2,(H,23,24) |
| InChIKey | RHBIJDHZGAULES-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|