C20H26ClNO4 — CID 87716876
2-chloro-3-[3-(diethylamino)-2-hydroxypropoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 87716876) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 2-chloro-3-[3-(diethylamino)-2-hydroxypropoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 2-chloro-3-[3-(diethylamino)-2-hydroxypropoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 87716876 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-chloro-3-[3-(diethylamino)-2-hydroxypropoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CCN(CC)CC(O)COc1cc2oc(=O)c3c(c2cc1Cl)CCCC3 |
| InChI | InChI=1S/C20H26ClNO4/c1-3-22(4-2)11-13(23)12-25-19-10-18-16(9-17(19)21)14-7-5-6-8-15(14)20(24)26-18/h9-10,13,23H,3-8,11-12H2,1-2H3 |
| InChIKey | VJCIYBKLSAPENN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|