C30H29ClO5 — CID 155968592
2-chloro-3-[2-hydroxy-3-[(2-methylphenyl)-phenylmethoxy]propoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 155968592) has the molecular formula C30H29ClO5 and a molecular weight of 505.01 g/mol. Its IUPAC name is 2-chloro-3-[2-hydroxy-3-[(2-methylphenyl)-phenylmethoxy]propoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 2-chloro-3-[2-hydroxy-3-[(2-methylphenyl)-phenylmethoxy]propoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 155968592 |
| Molecular Formula | C30H29ClO5 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 2-chloro-3-[2-hydroxy-3-[(2-methylphenyl)-phenylmethoxy]propoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | Cc1ccccc1C(OCC(O)COc1cc2oc(=O)c3c(c2cc1Cl)CCCC3)c1ccccc1 |
| InChI | InChI=1S/C30H29ClO5/c1-19-9-5-6-12-22(19)29(20-10-3-2-4-11-20)35-18-21(32)17-34-28-16-27-25(15-26(28)31)23-13-7-8-14-24(23)30(33)36-27/h2-6,9-12,15-16,21,29,32H,7-8,13-14,17-18H2,1H3 |
| InChIKey | SPTXQZKBHIOWEU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|