C26H25ClN2O5 — CID 99980237
(1R,9S)-11-[(2R)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 99980237) has the molecular formula C26H25ClN2O5 and a molecular weight of 480.95 g/mol. Its IUPAC name is (1R,9S)-11-[(2R)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-[(2R)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 99980237 |
| Molecular Formula | C26H25ClN2O5 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (1R,9S)-11-[(2R)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | C[C@@H](Oc1cc2oc(=O)c3c(c2cc1Cl)CCC3)C(=O)N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C26H25ClN2O5/c1-14(25(31)28-11-15-8-16(13-28)21-6-3-7-24(30)29(21)12-15)33-23-10-22-19(9-20(23)27)17-4-2-5-18(17)26(32)34-22/h3,6-7,9-10,14-16H,2,4-5,8,11-13H2,1H3/t14-,15+,16-/m1/s1 |
| InChIKey | JFNMDBVMRGQXAH-OWCLPIDISA-N |
| XLogP | 3.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|