C13H10ClO5- — CID 6924639
(2S)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoate (PubChem CID 6924639) has the molecular formula C13H10ClO5- and a molecular weight of 281.67 g/mol. Its IUPAC name is (2S)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoate.
| Compound Name | (2S)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoate |
|---|---|
| PubChem CID | 6924639 |
| Molecular Formula | C13H10ClO5- |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | (2S)-2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxypropanoate |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H](C)C(=O)[O-])c(Cl)cc12 |
| InChI | InChI=1S/C13H11ClO5/c1-6-3-12(15)19-10-5-11(9(14)4-8(6)10)18-7(2)13(16)17/h3-5,7H,1-2H3,(H,16,17)/p-1/t7-/m0/s1 |
| InChIKey | UBJGTVXAFAIJDS-ZETCQYMHSA-M |
| XLogP | 1.27 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|