C20H23NO5 — CID 171912849
7-[1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one (PubChem CID 171912849) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 7-[1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one.
| Compound Name | 7-[1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 171912849 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 7-[1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OC(C)C(=O)N3C[C@H]4COC[C@H]4C3)cc2oc1=O |
| InChI | InChI=1S/C20H23NO5/c1-11-12(2)20(23)26-18-6-16(4-5-17(11)18)25-13(3)19(22)21-7-14-9-24-10-15(14)8-21/h4-6,13-15H,7-10H2,1-3H3/t13?,14-,15+ |
| InChIKey | ZGQQIFBPFOOGKD-GOOCMWNKSA-N |
| XLogP | 2.28 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|