C22H27NO5 — CID 172669271
7-[1-[(1S,5R)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one (PubChem CID 172669271) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 7-[1-[(1S,5R)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one.
| Compound Name | 7-[1-[(1S,5R)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 172669271 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-[1-[(1S,5R)-8-methoxy-3-azabicyclo[3.2.1]octan-3-yl]-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one |
| SMILES | COC1[C@@H]2CC[C@H]1CN(C(=O)C(C)Oc1ccc3c(C)c(C)c(=O)oc3c1)C2 |
| InChI | InChI=1S/C22H27NO5/c1-12-13(2)22(25)28-19-9-17(7-8-18(12)19)27-14(3)21(24)23-10-15-5-6-16(11-23)20(15)26-4/h7-9,14-16,20H,5-6,10-11H2,1-4H3/t14?,15-,16+,20? |
| InChIKey | DZQROIOJWCJOFF-QKSYQBNISA-N |
| XLogP | 3.06 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|