C22H24FN3O5S — CID 18565424
(E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]prop-2-enamide (PubChem CID 18565424) has the molecular formula C22H24FN3O5S and a molecular weight of 461.52 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 18565424 |
| Molecular Formula | C22H24FN3O5S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(4-fluorophenyl)piperazin-1-yl]sulfonylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCCS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H24FN3O5S/c23-18-3-5-19(6-4-18)25-10-12-26(13-11-25)32(28,29)14-9-24-22(27)8-2-17-1-7-20-21(15-17)31-16-30-20/h1-8,15H,9-14,16H2,(H,24,27)/b8-2+ |
| InChIKey | KNIJSSWXSWELLJ-KRXBUXKQSA-N |
| XLogP | 1.84 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|