C16H19NO2 — CID 86001004
5-(4-hydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 86001004) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one.
| Compound Name | 5-(4-hydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 86001004 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5-(4-hydroxyphenyl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(C=CC=Cc1ccc(O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C16H19NO2/c18-15-10-8-14(9-11-15)6-2-3-7-16(19)17-12-4-1-5-13-17/h2-3,6-11,18H,1,4-5,12-13H2 |
| InChIKey | QDAARMDLSCDBFU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|