C14H20N2O — CID 108990934
N,3-dimethyl-N-phenylpiperidine-1-carboxamide (PubChem CID 108990934) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N,3-dimethyl-N-phenylpiperidine-1-carboxamide.
| Compound Name | N,3-dimethyl-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108990934 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N,3-dimethyl-N-phenylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)N(C)c2ccccc2)C1 |
| InChI | InChI=1S/C14H20N2O/c1-12-7-6-10-16(11-12)14(17)15(2)13-8-4-3-5-9-13/h3-5,8-9,12H,6-7,10-11H2,1-2H3 |
| InChIKey | HILXWUYUAXTFNH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |