C19H28N4O3 — CID 96571011
N-[(3S)-1-[methyl(phenyl)carbamoyl]azepan-3-yl]morpholine-4-carboxamide (PubChem CID 96571011) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(3S)-1-[methyl(phenyl)carbamoyl]azepan-3-yl]morpholine-4-carboxamide.
| Compound Name | N-[(3S)-1-[methyl(phenyl)carbamoyl]azepan-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 96571011 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[(3S)-1-[methyl(phenyl)carbamoyl]azepan-3-yl]morpholine-4-carboxamide |
| SMILES | CN(C(=O)N1CCCC[C@H](NC(=O)N2CCOCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C19H28N4O3/c1-21(17-8-3-2-4-9-17)19(25)23-10-6-5-7-16(15-23)20-18(24)22-11-13-26-14-12-22/h2-4,8-9,16H,5-7,10-15H2,1H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | MMWZFTWFFCIKSG-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |