C10H14NO3- — CID 2512801
(Z)-4-[(3R)-3-methylpiperidin-1-yl]-4-oxobut-2-enoate (PubChem CID 2512801) has the molecular formula C10H14NO3- and a molecular weight of 196.23 g/mol. Its IUPAC name is (Z)-4-[(3R)-3-methylpiperidin-1-yl]-4-oxobut-2-enoate.
| Compound Name | (Z)-4-[(3R)-3-methylpiperidin-1-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2512801 |
| Molecular Formula | C10H14NO3- |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (Z)-4-[(3R)-3-methylpiperidin-1-yl]-4-oxobut-2-enoate |
| SMILES | C[C@@H]1CCCN(C(=O)/C=C\C(=O)[O-])C1 |
| InChI | InChI=1S/C10H15NO3/c1-8-3-2-6-11(7-8)9(12)4-5-10(13)14/h4-5,8H,2-3,6-7H2,1H3,(H,13,14)/p-1/b5-4-/t8-/m1/s1 |
| InChIKey | MUGVIRKRXMKLES-PULIVWKDSA-M |
| XLogP | -0.45 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|