C12H15NO — CID 130942712
(3S,4S)-4-phenylmethoxypent-1-yn-3-amine (PubChem CID 130942712) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (3S,4S)-4-phenylmethoxypent-1-yn-3-amine.
| Compound Name | (3S,4S)-4-phenylmethoxypent-1-yn-3-amine |
|---|---|
| PubChem CID | 130942712 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3S,4S)-4-phenylmethoxypent-1-yn-3-amine |
| SMILES | C#C[C@H](N)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C12H15NO/c1-3-12(13)10(2)14-9-11-7-5-4-6-8-11/h1,4-8,10,12H,9,13H2,2H3/t10-,12-/m0/s1 |
| InChIKey | XMQVZMAZGRBJFO-JQWIXIFHSA-N |
| XLogP | 1.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|