About 2-amino-3-phenylmethoxybutan-1-ol;methane
2-amino-3-phenylmethoxybutan-1-ol;methane (PubChem CID 162219428) has the molecular formula C12H21NO2
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-amino-3-phenylmethoxybutan-1-ol;methane.
Molecular Properties
| Compound Name | 2-amino-3-phenylmethoxybutan-1-ol;methane |
| PubChem CID | 162219428 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-amino-3-phenylmethoxybutan-1-ol;methane |
| SMILES | C.CC(OCc1ccccc1)C(N)CO |
| InChI | InChI=1S/C11H17NO2.CH4/c1-9(11(12)7-13)14-8-10-5-3-2-4-6-10;/h2-6,9,11,13H,7-8,12H2,1H3;1H4 |
| InChIKey | ZTXORYDAMVMWHQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-phenylmethoxybutan-1-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-phenylmethoxybutan-1-ol;methane?
The IUPAC name of 2-amino-3-phenylmethoxybutan-1-ol;methane (CID 162219428) is 2-amino-3-phenylmethoxybutan-1-ol;methane.
What is the SMILES notation for 2-amino-3-phenylmethoxybutan-1-ol;methane?
The canonical SMILES for 2-amino-3-phenylmethoxybutan-1-ol;methane is C.CC(OCc1ccccc1)C(N)CO.
What is the InChIKey of 2-amino-3-phenylmethoxybutan-1-ol;methane?
The InChIKey is ZTXORYDAMVMWHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2.CH4/c1-9(11(12)7-13)14-8-10-5-3-2-4-6-10;/h2-6,9,11,13H,7-8,12H2,1H3;1H4.
What are the key properties of 2-amino-3-phenylmethoxybutan-1-ol;methane?
2-amino-3-phenylmethoxybutan-1-ol;methane has a molecular weight of 211.31 g/mol, XLogP of 1.55, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-phenylmethoxybutan-1-ol;methane is sourced from PubChem (CID 162219428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).