C26H26N6O3 — CID 90052909
2-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione (PubChem CID 90052909) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90052909 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[5-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione |
| SMILES | CCCNc1nc(Nc2ccnc(OC)c2)ncc1C#CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H26N6O3/c1-3-13-28-23-18(17-29-26(31-23)30-19-12-14-27-22(16-19)35-2)9-5-4-8-15-32-24(33)20-10-6-7-11-21(20)25(32)34/h6-7,10-12,14,16-17H,3-4,8,13,15H2,1-2H3,(H2,27,28,29,30,31) |
| InChIKey | RIFJAFAWSSQTDX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|