C27H35N7O3 — CID 140666478
(2S,3Z)-3-ethylidene-N-[3-[2-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclobutyl]-N',2-dimethylbutanediamide (PubChem CID 140666478) has the molecular formula C27H35N7O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is (2S,3Z)-3-ethylidene-N-[3-[2-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclobutyl]-N',2-dimethylbutanediamide.
| Compound Name | (2S,3Z)-3-ethylidene-N-[3-[2-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclobutyl]-N',2-dimethylbutanediamide |
|---|---|
| PubChem CID | 140666478 |
| Molecular Formula | C27H35N7O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (2S,3Z)-3-ethylidene-N-[3-[2-[2-[(2-methoxy-4-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclobutyl]-N',2-dimethylbutanediamide |
| SMILES | C/C=C(\C(=O)NC)[C@H](C)C(=O)NC1CC(C#Cc2cnc(Nc3ccnc(OC)c3)nc2NCCC)C1 |
| InChI | InChI=1S/C27H35N7O3/c1-6-11-30-24-19(16-31-27(34-24)33-20-10-12-29-23(15-20)37-5)9-8-18-13-21(14-18)32-25(35)17(3)22(7-2)26(36)28-4/h7,10,12,15-18,21H,6,11,13-14H2,1-5H3,(H,28,36)(H,32,35)(H2,29,30,31,33,34)/b22-7-/t17-,18?,21?/m0/s1 |
| InChIKey | CXSLMQRMLLCHGA-LYQLMWHBSA-N |
| XLogP | 3.02 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|