C26H34FN5O — CID 157206973
(2R)-N-[(1S,3R)-3-[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclohexyl]-2-methylbutanamide (PubChem CID 157206973) has the molecular formula C26H34FN5O and a molecular weight of 451.59 g/mol. Its IUPAC name is (2R)-N-[(1S,3R)-3-[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclohexyl]-2-methylbutanamide.
| Compound Name | (2R)-N-[(1S,3R)-3-[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclohexyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 157206973 |
| Molecular Formula | C26H34FN5O |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | (2R)-N-[(1S,3R)-3-[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]ethynyl]cyclohexyl]-2-methylbutanamide |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C#C[C@@H]1CCC[C@H](NC(=O)[C@H](C)CC)C1 |
| InChI | InChI=1S/C26H34FN5O/c1-4-14-28-24-20(17-29-26(32-24)31-23-11-7-9-21(27)16-23)13-12-19-8-6-10-22(15-19)30-25(33)18(3)5-2/h7,9,11,16-19,22H,4-6,8,10,14-15H2,1-3H3,(H,30,33)(H2,28,29,31,32)/t18-,19+,22+/m1/s1 |
| InChIKey | HCRISHBCHONHMO-DXIQSLLYSA-N |
| XLogP | 5.25 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|