C27H23FN6O2 — CID 90052772
4-[[5-[5-(1,3-dioxoisoindol-2-yl)pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-2-fluorobenzonitrile (PubChem CID 90052772) has the molecular formula C27H23FN6O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is 4-[[5-[5-(1,3-dioxoisoindol-2-yl)pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-2-fluorobenzonitrile.
| Compound Name | 4-[[5-[5-(1,3-dioxoisoindol-2-yl)pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 90052772 |
| Molecular Formula | C27H23FN6O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 4-[[5-[5-(1,3-dioxoisoindol-2-yl)pent-1-ynyl]-4-(propylamino)pyrimidin-2-yl]amino]-2-fluorobenzonitrile |
| SMILES | CCCNc1nc(Nc2ccc(C#N)c(F)c2)ncc1C#CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H23FN6O2/c1-2-13-30-24-19(17-31-27(33-24)32-20-12-11-18(16-29)23(28)15-20)8-4-3-7-14-34-25(35)21-9-5-6-10-22(21)26(34)36/h5-6,9-12,15,17H,2-3,7,13-14H2,1H3,(H2,30,31,32,33) |
| InChIKey | JHKSGWWZTZETJS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|