C19H24FN5O — CID 90052152
5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine (PubChem CID 90052152) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 90052152 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 5-(5-aminopent-1-ynyl)-2-N-(3-fluorophenyl)-4-N-(3-methoxypropyl)pyrimidine-2,4-diamine |
| SMILES | COCCCNc1nc(Nc2cccc(F)c2)ncc1C#CCCCN |
| InChI | InChI=1S/C19H24FN5O/c1-26-12-6-11-22-18-15(7-3-2-4-10-21)14-23-19(25-18)24-17-9-5-8-16(20)13-17/h5,8-9,13-14H,2,4,6,10-12,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | YJRNVSVWHIOQBD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|