C27H26FN5O2 — CID 90053200
2-[5-[2-(3-fluoroanilino)-4-[methyl(propyl)amino]pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione (PubChem CID 90053200) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[5-[2-(3-fluoroanilino)-4-[methyl(propyl)amino]pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[2-(3-fluoroanilino)-4-[methyl(propyl)amino]pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90053200 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-[5-[2-(3-fluoroanilino)-4-[methyl(propyl)amino]pyrimidin-5-yl]pent-4-ynyl]isoindole-1,3-dione |
| SMILES | CCCN(C)c1nc(Nc2cccc(F)c2)ncc1C#CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H26FN5O2/c1-3-15-32(2)24-19(18-29-27(31-24)30-21-12-9-11-20(28)17-21)10-5-4-8-16-33-25(34)22-13-6-7-14-23(22)26(33)35/h6-7,9,11-14,17-18H,3-4,8,15-16H2,1-2H3,(H,29,30,31) |
| InChIKey | KWJMSWWJJQYCJX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|