C28H43N9O3 — CID 90052712
2-(4-carbamoylanilino)-N-[3-[[1-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-2-methylpropan-2-yl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide (PubChem CID 90052712) has the molecular formula C28H43N9O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is 2-(4-carbamoylanilino)-N-[3-[[1-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-2-methylpropan-2-yl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-carbamoylanilino)-N-[3-[[1-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-2-methylpropan-2-yl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90052712 |
| Molecular Formula | C28H43N9O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | 2-(4-carbamoylanilino)-N-[3-[[1-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-2-methylpropan-2-yl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide |
| SMILES | CCCNc1nc(Nc2ccc(C(N)=O)cc2)ncc1C(=O)NCCCNC(C)(C)CNC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C28H43N9O3/c1-6-14-30-25-22(18-32-27(36-25)35-21-12-10-20(11-13-21)24(29)39)26(40)31-15-8-16-34-28(2,3)19-33-23(38)9-7-17-37(4)5/h7,9-13,18,34H,6,8,14-17,19H2,1-5H3,(H2,29,39)(H,31,40)(H,33,38)(H2,30,32,35,36)/b9-7+ |
| InChIKey | NFBMHCBQIYEKTK-VQHVLOKHSA-N |
| XLogP | 1.86 |
| TPSA | 166.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|