C27H39N9O4 — CID 90052724
2-(4-carbamoylanilino)-N-[3-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]propanoyl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide (PubChem CID 90052724) has the molecular formula C27H39N9O4 and a molecular weight of 553.67 g/mol. Its IUPAC name is 2-(4-carbamoylanilino)-N-[3-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]propanoyl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-carbamoylanilino)-N-[3-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]propanoyl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 90052724 |
| Molecular Formula | C27H39N9O4 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | 2-(4-carbamoylanilino)-N-[3-[[(2S)-2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]propanoyl]amino]propyl]-4-(propylamino)pyrimidine-5-carboxamide |
| SMILES | CCCNc1nc(Nc2ccc(C(N)=O)cc2)ncc1C(=O)NCCCNC(=O)[C@H](C)NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C27H39N9O4/c1-5-13-29-24-21(17-32-27(35-24)34-20-11-9-19(10-12-20)23(28)38)26(40)31-15-7-14-30-25(39)18(2)33-22(37)8-6-16-36(3)4/h6,8-12,17-18H,5,7,13-16H2,1-4H3,(H2,28,38)(H,30,39)(H,31,40)(H,33,37)(H2,29,32,34,35)/b8-6+/t18-/m0/s1 |
| InChIKey | IDDPJDAOALETIT-IWHGQQBYSA-N |
| XLogP | 1.00 |
| TPSA | 183.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|