C28H42N8O2 — CID 163968937
(2S)-2-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]-methylamino]-N-[5-[2-[(6-methyl-3-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide (PubChem CID 163968937) has the molecular formula C28H42N8O2 and a molecular weight of 522.70 g/mol. Its IUPAC name is (2S)-2-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]-methylamino]-N-[5-[2-[(6-methyl-3-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide.
| Compound Name | (2S)-2-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]-methylamino]-N-[5-[2-[(6-methyl-3-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide |
|---|---|
| PubChem CID | 163968937 |
| Molecular Formula | C28H42N8O2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | (2S)-2-[[(E)-4-(dimethylamino)-1-hydroxybut-2-enyl]-methylamino]-N-[5-[2-[(6-methyl-3-pyridinyl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide |
| SMILES | CCCNc1nc(Nc2ccc(C)nc2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(O)/C=C/CN(C)C |
| InChI | InChI=1S/C28H42N8O2/c1-7-16-29-26-23(19-32-28(34-26)33-24-15-14-21(2)31-20-24)12-9-8-10-17-30-27(38)22(3)36(6)25(37)13-11-18-35(4)5/h11,13-15,19-20,22,25,37H,7-8,10,16-18H2,1-6H3,(H,30,38)(H2,29,32,33,34)/b13-11+/t22-,25?/m0/s1 |
| InChIKey | SOHCMXOCDJLHQD-NAQGIECBSA-N |
| XLogP | 2.75 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|