C21H28FN7O — CID 90052515
N-[(E)-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-3-iminopent-4-enyl]-2-(methylamino)acetamide (PubChem CID 90052515) has the molecular formula C21H28FN7O and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[(E)-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-3-iminopent-4-enyl]-2-(methylamino)acetamide.
| Compound Name | N-[(E)-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-3-iminopent-4-enyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 90052515 |
| Molecular Formula | C21H28FN7O |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[(E)-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-3-iminopent-4-enyl]-2-(methylamino)acetamide |
| SMILES | [H]/N=C(/C=C/c1cnc(Nc2cccc(F)c2)nc1NCCC)CCNC(=O)CNC |
| InChI | InChI=1S/C21H28FN7O/c1-3-10-26-20-15(7-8-17(23)9-11-25-19(30)14-24-2)13-27-21(29-20)28-18-6-4-5-16(22)12-18/h4-8,12-13,23-24H,3,9-11,14H2,1-2H3,(H,25,30)(H2,26,27,28,29)/b8-7+,23-17- |
| InChIKey | DFPCUYIEOUKDKL-GHCDYGQPSA-N |
| XLogP | 2.94 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|