C15H15FN4S — CID 103323565
4-N-(3-fluorophenyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 103323565) has the molecular formula C15H15FN4S and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-N-(3-fluorophenyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-fluorophenyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103323565 |
| Molecular Formula | C15H15FN4S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-N-(3-fluorophenyl)-2-N-propylthieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)c2ccsc2n1 |
| InChI | InChI=1S/C15H15FN4S/c1-2-7-17-15-19-13(12-6-8-21-14(12)20-15)18-11-5-3-4-10(16)9-11/h3-6,8-9H,2,7H2,1H3,(H2,17,18,19,20) |
| InChIKey | FUNKQNTUWGJNDM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |