C16H18FN5O — CID 68622908
3-[[5-cyclopropyl-2-(4-fluoroanilino)pyrimidin-4-yl]amino]propanamide (PubChem CID 68622908) has the molecular formula C16H18FN5O and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-[[5-cyclopropyl-2-(4-fluoroanilino)pyrimidin-4-yl]amino]propanamide.
| Compound Name | 3-[[5-cyclopropyl-2-(4-fluoroanilino)pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 68622908 |
| Molecular Formula | C16H18FN5O |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[[5-cyclopropyl-2-(4-fluoroanilino)pyrimidin-4-yl]amino]propanamide |
| SMILES | NC(=O)CCNc1nc(Nc2ccc(F)cc2)ncc1C1CC1 |
| InChI | InChI=1S/C16H18FN5O/c17-11-3-5-12(6-4-11)21-16-20-9-13(10-1-2-10)15(22-16)19-8-7-14(18)23/h3-6,9-10H,1-2,7-8H2,(H2,18,23)(H2,19,20,21,22) |
| InChIKey | GXRCMIMWAZTUHH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |