C23H26N6O2S — CID 59225254
N-[3-[[2-(4-acetamidoanilino)-5-cyclopropylpyrimidin-4-yl]amino]propyl]thiophene-2-carboxamide (PubChem CID 59225254) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is N-[3-[[2-(4-acetamidoanilino)-5-cyclopropylpyrimidin-4-yl]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-(4-acetamidoanilino)-5-cyclopropylpyrimidin-4-yl]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59225254 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[3-[[2-(4-acetamidoanilino)-5-cyclopropylpyrimidin-4-yl]amino]propyl]thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncc(C3CC3)c(NCCCNC(=O)c3cccs3)n2)cc1 |
| InChI | InChI=1S/C23H26N6O2S/c1-15(30)27-17-7-9-18(10-8-17)28-23-26-14-19(16-5-6-16)21(29-23)24-11-3-12-25-22(31)20-4-2-13-32-20/h2,4,7-10,13-14,16H,3,5-6,11-12H2,1H3,(H,25,31)(H,27,30)(H2,24,26,28,29) |
| InChIKey | XDFFILLECMHXEB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|