C15H12ClN5 — CID 24990162
4-(3-amino-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine (PubChem CID 24990162) has the molecular formula C15H12ClN5 and a molecular weight of 297.75 g/mol. Its IUPAC name is 4-(3-amino-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(3-amino-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 24990162 |
| Molecular Formula | C15H12ClN5 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-(3-amino-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine |
| SMILES | Nc1cnccc1-c1ccnc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H12ClN5/c16-10-2-1-3-11(8-10)20-15-19-7-5-14(21-15)12-4-6-18-9-13(12)17/h1-9H,17H2,(H,19,20,21) |
| InChIKey | VHLOHNCTEDBADG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |