C21H26N6OS — CID 20741320
[1-[3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]anilino]propyl]pyrrolidin-2-yl]methanol (PubChem CID 20741320) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is [1-[3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]anilino]propyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]anilino]propyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 20741320 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [1-[3-[3-[[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]amino]anilino]propyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1CCCNc1cccc(Nc2nccc(-c3nccs3)n2)c1 |
| InChI | InChI=1S/C21H26N6OS/c28-15-18-6-2-11-27(18)12-3-8-22-16-4-1-5-17(14-16)25-21-24-9-7-19(26-21)20-23-10-13-29-20/h1,4-5,7,9-10,13-14,18,22,28H,2-3,6,8,11-12,15H2,(H,24,25,26) |
| InChIKey | NNNRUNMINIEAHZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|