C17H24ClN5 — CID 119126175
3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1H-imidazol-2-ylmethyl)propan-1-amine (PubChem CID 119126175) has the molecular formula C17H24ClN5 and a molecular weight of 333.87 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1H-imidazol-2-ylmethyl)propan-1-amine.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1H-imidazol-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 119126175 |
| Molecular Formula | C17H24ClN5 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1H-imidazol-2-ylmethyl)propan-1-amine |
| SMILES | Clc1cccc(N2CCN(CCCNCc3ncc[nH]3)CC2)c1 |
| InChI | InChI=1S/C17H24ClN5/c18-15-3-1-4-16(13-15)23-11-9-22(10-12-23)8-2-5-19-14-17-20-6-7-21-17/h1,3-4,6-7,13,19H,2,5,8-12,14H2,(H,20,21) |
| InChIKey | RHQGRNGDVXSIAR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|