C14H17ClN4 — CID 96564403
(3S)-1-(3-chlorophenyl)-N-(1H-imidazol-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 96564403) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is (3S)-1-(3-chlorophenyl)-N-(1H-imidazol-2-ylmethyl)pyrrolidin-3-amine.
| Compound Name | (3S)-1-(3-chlorophenyl)-N-(1H-imidazol-2-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 96564403 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3S)-1-(3-chlorophenyl)-N-(1H-imidazol-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | Clc1cccc(N2CC[C@H](NCc3ncc[nH]3)C2)c1 |
| InChI | InChI=1S/C14H17ClN4/c15-11-2-1-3-13(8-11)19-7-4-12(10-19)18-9-14-16-5-6-17-14/h1-3,5-6,8,12,18H,4,7,9-10H2,(H,16,17)/t12-/m0/s1 |
| InChIKey | LHBSTKCUYDUXLA-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |