C16H22ClN5S — CID 133320629
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 133320629) has the molecular formula C16H22ClN5S and a molecular weight of 351.91 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133320629 |
| Molecular Formula | C16H22ClN5S |
| Molecular Weight | 351.91 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(NCCCN2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C16H22ClN5S/c1-13-19-16(23-20-13)18-6-3-7-21-8-10-22(11-9-21)15-5-2-4-14(17)12-15/h2,4-5,12H,3,6-11H2,1H3,(H,18,19,20) |
| InChIKey | LXVVFYDHAFLXPD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|