C19H26ClN5 — CID 118259497
3-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(Z)-(1-methyl-2-pyridinylidene)amino]propan-1-amine (PubChem CID 118259497) has the molecular formula C19H26ClN5 and a molecular weight of 359.91 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(Z)-(1-methyl-2-pyridinylidene)amino]propan-1-amine.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(Z)-(1-methyl-2-pyridinylidene)amino]propan-1-amine |
|---|---|
| PubChem CID | 118259497 |
| Molecular Formula | C19H26ClN5 |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-[(Z)-(1-methyl-2-pyridinylidene)amino]propan-1-amine |
| SMILES | Cn1cccc/c1=N/NCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26ClN5/c1-23-10-3-2-8-19(23)22-21-9-5-11-24-12-14-25(15-13-24)18-7-4-6-17(20)16-18/h2-4,6-8,10,16,21H,5,9,11-15H2,1H3/b22-19- |
| InChIKey | IIAOSEMGMTXMKC-QOCHGBHMSA-N |
| XLogP | 2.30 |
| TPSA | 35.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|