C11H9N3S — CID 60689652
3-(1,3-thiazol-4-ylmethylamino)benzonitrile (PubChem CID 60689652) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethylamino)benzonitrile.
| Compound Name | 3-(1,3-thiazol-4-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 60689652 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cccc(NCc2cscn2)c1 |
| InChI | InChI=1S/C11H9N3S/c12-5-9-2-1-3-10(4-9)13-6-11-7-15-8-14-11/h1-4,7-8,13H,6H2 |
| InChIKey | MTRLRCHFKFZJNI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |