2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid

C13H11N3O2S — CID 82124046

IUPAC2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid
SMILESN#Cc1cccc(NCc2nc(CC(=O)O)cs2)c1
InChIInChI=1S/C13H11N3O2S/c14-6-9-2-1-3-10(4-9)15-7-12-16-11(8-19-12)5-13(17)18/h1-4,8,15H,5,7H2,(H,17,18)
InChIKeyFJRZGPKGBNUXIJ-UHFFFAOYSA-N
MW273.32 g/mol
LogP2.25
Rot. Bonds5

About 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid

2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 82124046) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid
PubChem CID82124046
Molecular FormulaC13H11N3O2S
Molecular Weight273.32 g/mol
Exact Mass273.06
IUPAC Name2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid
SMILESN#Cc1cccc(NCc2nc(CC(=O)O)cs2)c1
InChIInChI=1S/C13H11N3O2S/c14-6-9-2-1-3-10(4-9)15-7-12-16-11(8-19-12)5-13(17)18/h1-4,8,15H,5,7H2,(H,17,18)
InChIKeyFJRZGPKGBNUXIJ-UHFFFAOYSA-N
XLogP2.25
TPSA86.01 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.32
LogP ≤ 52.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid (CID 82124046) is 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid is N#Cc1cccc(NCc2nc(CC(=O)O)cs2)c1.
What is the InChIKey of 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is FJRZGPKGBNUXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S/c14-6-9-2-1-3-10(4-9)15-7-12-16-11(8-19-12)5-13(17)18/h1-4,8,15H,5,7H2,(H,17,18).
What are the key properties of 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 273.32 g/mol, XLogP of 2.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3-cyanoanilino)methyl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 82124046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).