About 3-(ethylamino)benzonitrile;3-oxobutanoic acid
3-(ethylamino)benzonitrile;3-oxobutanoic acid (PubChem CID 174667685) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(ethylamino)benzonitrile;3-oxobutanoic acid.
Molecular Properties
| Compound Name | 3-(ethylamino)benzonitrile;3-oxobutanoic acid |
| PubChem CID | 174667685 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(ethylamino)benzonitrile;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.CCNc1cccc(C#N)c1 |
| InChI | InChI=1S/C9H10N2.C4H6O3/c1-2-11-9-5-3-4-8(6-9)7-10;1-3(5)2-4(6)7/h3-6,11H,2H2,1H3;2H2,1H3,(H,6,7) |
| InChIKey | GIZKRRHAFYVGQX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylamino)benzonitrile;3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)benzonitrile;3-oxobutanoic acid?
The IUPAC name of 3-(ethylamino)benzonitrile;3-oxobutanoic acid (CID 174667685) is 3-(ethylamino)benzonitrile;3-oxobutanoic acid.
What is the SMILES notation for 3-(ethylamino)benzonitrile;3-oxobutanoic acid?
The canonical SMILES for 3-(ethylamino)benzonitrile;3-oxobutanoic acid is CC(=O)CC(=O)O.CCNc1cccc(C#N)c1.
What is the InChIKey of 3-(ethylamino)benzonitrile;3-oxobutanoic acid?
The InChIKey is GIZKRRHAFYVGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C4H6O3/c1-2-11-9-5-3-4-8(6-9)7-10;1-3(5)2-4(6)7/h3-6,11H,2H2,1H3;2H2,1H3,(H,6,7).
What are the key properties of 3-(ethylamino)benzonitrile;3-oxobutanoic acid?
3-(ethylamino)benzonitrile;3-oxobutanoic acid has a molecular weight of 248.28 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)benzonitrile;3-oxobutanoic acid is sourced from PubChem (CID 174667685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).