C13H12BrNO2S — CID 114895904
5-bromo-2-[(4-methylthiophen-3-yl)methylamino]benzoic acid (PubChem CID 114895904) has the molecular formula C13H12BrNO2S and a molecular weight of 326.22 g/mol. Its IUPAC name is 5-bromo-2-[(4-methylthiophen-3-yl)methylamino]benzoic acid.
| Compound Name | 5-bromo-2-[(4-methylthiophen-3-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 114895904 |
| Molecular Formula | C13H12BrNO2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 5-bromo-2-[(4-methylthiophen-3-yl)methylamino]benzoic acid |
| SMILES | Cc1cscc1CNc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C13H12BrNO2S/c1-8-6-18-7-9(8)5-15-12-3-2-10(14)4-11(12)13(16)17/h2-4,6-7,15H,5H2,1H3,(H,16,17) |
| InChIKey | PRSLKVQSKKWUGI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |