C13H18N4O2S — CID 61451158
N,N-diethyl-2-[(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)-methylamino]acetamide (PubChem CID 61451158) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is N,N-diethyl-2-[(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)-methylamino]acetamide.
| Compound Name | N,N-diethyl-2-[(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)-methylamino]acetamide |
|---|---|
| PubChem CID | 61451158 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N,N-diethyl-2-[(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)-methylamino]acetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1nc2sccn2c1C=O |
| InChI | InChI=1S/C13H18N4O2S/c1-4-16(5-2)11(19)8-15(3)12-10(9-18)17-6-7-20-13(17)14-12/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | KOODBQOHBSGEDU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|