C14H13Br2N3S — CID 107081020
5-(bromomethyl)-N-[(2-bromophenyl)methyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 107081020) has the molecular formula C14H13Br2N3S and a molecular weight of 415.15 g/mol. Its IUPAC name is 5-(bromomethyl)-N-[(2-bromophenyl)methyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(bromomethyl)-N-[(2-bromophenyl)methyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 107081020 |
| Molecular Formula | C14H13Br2N3S |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.92 |
| IUPAC Name | 5-(bromomethyl)-N-[(2-bromophenyl)methyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CN(Cc1ccccc1Br)c1nc2sccn2c1CBr |
| InChI | InChI=1S/C14H13Br2N3S/c1-18(9-10-4-2-3-5-11(10)16)13-12(8-15)19-6-7-20-14(19)17-13/h2-7H,8-9H2,1H3 |
| InChIKey | YXONEUPSDLHFOH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|