C15H15BrFN3S — CID 107083113
5-(bromomethyl)-N-[1-(2-fluorophenyl)ethyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 107083113) has the molecular formula C15H15BrFN3S and a molecular weight of 368.28 g/mol. Its IUPAC name is 5-(bromomethyl)-N-[1-(2-fluorophenyl)ethyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(bromomethyl)-N-[1-(2-fluorophenyl)ethyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 107083113 |
| Molecular Formula | C15H15BrFN3S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 5-(bromomethyl)-N-[1-(2-fluorophenyl)ethyl]-N-methylimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CC(c1ccccc1F)N(C)c1nc2sccn2c1CBr |
| InChI | InChI=1S/C15H15BrFN3S/c1-10(11-5-3-4-6-12(11)17)19(2)14-13(9-16)20-7-8-21-15(20)18-14/h3-8,10H,9H2,1-2H3 |
| InChIKey | YCQIDDFYBBGNHN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|