C13H20BrN3O2S — CID 107082047
5-(bromomethyl)-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 107082047) has the molecular formula C13H20BrN3O2S and a molecular weight of 362.29 g/mol. Its IUPAC name is 5-(bromomethyl)-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(bromomethyl)-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 107082047 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 5-(bromomethyl)-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)imidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | COCCN(c1nc2sccn2c1CBr)C(C)COC |
| InChI | InChI=1S/C13H20BrN3O2S/c1-10(9-19-3)16(4-6-18-2)12-11(8-14)17-5-7-20-13(17)15-12/h5,7,10H,4,6,8-9H2,1-3H3 |
| InChIKey | HVWNQTLWQSKIAH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|