C14H24N4S — CID 55001985
5-(aminomethyl)-N-pentyl-N-propan-2-ylimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 55001985) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 5-(aminomethyl)-N-pentyl-N-propan-2-ylimidazo[2,1-b][1,3]thiazol-6-amine.
| Compound Name | 5-(aminomethyl)-N-pentyl-N-propan-2-ylimidazo[2,1-b][1,3]thiazol-6-amine |
|---|---|
| PubChem CID | 55001985 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 5-(aminomethyl)-N-pentyl-N-propan-2-ylimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CCCCCN(c1nc2sccn2c1CN)C(C)C |
| InChI | InChI=1S/C14H24N4S/c1-4-5-6-7-17(11(2)3)13-12(10-15)18-8-9-19-14(18)16-13/h8-9,11H,4-7,10,15H2,1-3H3 |
| InChIKey | RQBNYYXSPZFXLP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|